C15H30O6Si — CID 25107870
methyl (2S,3R)-4-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-2,3-dihydroxybutanoate (PubChem CID 25107870) has the molecular formula C15H30O6Si and a molecular weight of 334.49 g/mol. Its IUPAC name is methyl (2S,3R)-4-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-2,3-dihydroxybutanoate.
| Compound Name | methyl (2S,3R)-4-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-2,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 25107870 |
| Molecular Formula | C15H30O6Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | methyl (2S,3R)-4-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-2,3-dihydroxybutanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)C[C@]1(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O6Si/c1-14(2,3)22(6,7)20-9-11-15(4,21-11)8-10(16)12(17)13(18)19-5/h10-12,16-17H,8-9H2,1-7H3/t10-,11+,12+,15+/m1/s1 |
| InChIKey | FDJUMIXZCCYXGL-YXMPFFBPSA-N |
| XLogP | 1.45 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|