C14H30O5Si — CID 135038443
ethyl (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyhexanoate (PubChem CID 135038443) has the molecular formula C14H30O5Si and a molecular weight of 306.48 g/mol. Its IUPAC name is ethyl (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyhexanoate.
| Compound Name | ethyl (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyhexanoate |
|---|---|
| PubChem CID | 135038443 |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | ethyl (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxyhexanoate |
| SMILES | CCOC(=O)C(O)C(O)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O5Si/c1-8-18-13(17)12(16)11(15)9-10(2)19-20(6,7)14(3,4)5/h10-12,15-16H,8-9H2,1-7H3/t10-,11?,12?/m1/s1 |
| InChIKey | SABFUABKVMTIOK-VOMCLLRMSA-N |
| XLogP | 2.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|