C14H26O6Si — CID 15720337
methyl (1R,3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 15720337) has the molecular formula C14H26O6Si and a molecular weight of 318.44 g/mol. Its IUPAC name is methyl (1R,3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (1R,3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 15720337 |
| Molecular Formula | C14H26O6Si |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | methyl (1R,3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H]1O2 |
| InChI | InChI=1S/C14H26O6Si/c1-13(2,3)21(5,6)20-8-7-14(12(17)18-4)11(19-14)10(16)9(8)15/h8-11,15-16H,7H2,1-6H3/t8-,9+,10+,11+,14-/m1/s1 |
| InChIKey | MWTWMNBBOZEEEJ-ADADXYTCSA-N |
| XLogP | 0.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|