C10H14O6 — CID 163038602
methyl 2-[(1R,2R,3R,6S)-2-hydroxy-3-methoxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]acetate (PubChem CID 163038602) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3R,6S)-2-hydroxy-3-methoxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]acetate.
| Compound Name | methyl 2-[(1R,2R,3R,6S)-2-hydroxy-3-methoxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 163038602 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | methyl 2-[(1R,2R,3R,6S)-2-hydroxy-3-methoxy-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(O)[C@@H]2O[C@@H]2C(=O)C[C@H]1OC |
| InChI | InChI=1S/C10H14O6/c1-14-6-3-5(11)8-9(16-8)10(6,13)4-7(12)15-2/h6,8-9,13H,3-4H2,1-2H3/t6-,8-,9-,10-/m1/s1 |
| InChIKey | AOJDAZKPGYADTA-PEBGCTIMSA-N |
| XLogP | -0.96 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|