C7H10O6 — CID 126961879
(1R,2R,3R,4S,5R,6S)-3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid (PubChem CID 126961879) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R,6S)-3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4S,5R,6S)-3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 126961879 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (1R,2R,3R,4S,5R,6S)-3,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C7H10O6/c8-2-1(7(11)12)5-6(13-5)4(10)3(2)9/h1-6,8-10H,(H,11,12)/t1-,2-,3+,4-,5-,6+/m1/s1 |
| InChIKey | UCSZNZKPWROYLI-RTWKJESVSA-N |
| XLogP | -2.45 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|