C13H22O5 — CID 11108014
tert-butyl 2-[(1R,2R,4S,6R)-2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]acetate (PubChem CID 11108014) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2R,4S,6R)-2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,2R,4S,6R)-2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 11108014 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | tert-butyl 2-[(1R,2R,4S,6R)-2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@]1(O)C[C@@H](O)C[C@H]2O[C@]21C |
| InChI | InChI=1S/C13H22O5/c1-11(2,3)18-10(15)7-13(16)6-8(14)5-9-12(13,4)17-9/h8-9,14,16H,5-7H2,1-4H3/t8-,9+,12+,13+/m0/s1 |
| InChIKey | BKTOMIBBJRYHEU-HIAZDOBYSA-N |
| XLogP | 0.76 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|