C14H28O6Si — CID 15720341
methyl (1S,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate (PubChem CID 15720341) has the molecular formula C14H28O6Si and a molecular weight of 320.46 g/mol. Its IUPAC name is methyl (1S,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15720341 |
| Molecular Formula | C14H28O6Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl (1S,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H28O6Si/c1-13(2,3)21(5,6)20-10-8-14(18,12(17)19-4)7-9(15)11(10)16/h9-11,15-16,18H,7-8H2,1-6H3/t9-,10-,11-,14+/m1/s1 |
| InChIKey | KATMPLSMLJQFHM-BIAAXOCRSA-N |
| XLogP | 0.80 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|