About methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate
methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate (PubChem CID 10702825) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate.
Analyze methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate?
The IUPAC name of methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate (CID 10702825) is methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate.
What is the SMILES notation for methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate?
The canonical SMILES for methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate is COC(=O)[C@@]1(O)CC[C@H](O)[C@H](O)C1.
What is the InChIKey of methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate?
The InChIKey is YPINFRCXOVFBJM-SHYZEUOFSA-N. The full InChI is InChI=1S/C8H14O5/c1-13-7(11)8(12)3-2-5(9)6(10)4-8/h5-6,9-10,12H,2-4H2,1H3/t5-,6+,8+/m0/s1.
What are the key properties of methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate?
methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate has a molecular weight of 190.19 g/mol, XLogP of -1.20, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R,3R,4S)-1,3,4-trihydroxycyclohexane-1-carboxylate is sourced from PubChem (CID 10702825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).