C11H20O6 — CID 102195025
trans-butyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate (PubChem CID 102195025) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is trans-butyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate.
| Compound Name | trans-butyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102195025 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | trans-butyl (3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
| SMILES | CCCCOC(=O)C1(O)C[C@@H](O)C(O)[C@H](O)C1 |
| InChI | InChI=1S/C11H20O6/c1-2-3-4-17-10(15)11(16)5-7(12)9(14)8(13)6-11/h7-9,12-14,16H,2-6H2,1H3/t7-,8-,9?,11?/m1/s1 |
| InChIKey | VUNJUWDTKPGAPN-BFWVQVCMSA-N |
| XLogP | -1.06 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|