C13H22CaO13 — CID 76965383
calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;trans-(3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate (PubChem CID 76965383) has the molecular formula C13H22CaO13 and a molecular weight of 426.38 g/mol. Its IUPAC name is calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;trans-(3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate.
| Compound Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;trans-(3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 76965383 |
| Molecular Formula | C13H22CaO13 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;trans-(3R,5R)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1(O)C[C@@H](O)C(O)[C@H](O)C1.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2] |
| InChI | InChI=1S/C7H12O6.C6H12O7.Ca/c8-3-1-7(13,6(11)12)2-4(9)5(3)10;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-5,8-10,13H,1-2H2,(H,11,12);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3-,4-,5?,7?;2-,3-,4+,5-;/m11./s1 |
| InChIKey | WMTXJJATAGXRNR-IMFKWKESSA-L |
| XLogP | -8.86 |
| TPSA | 262.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | -8.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |