C20H40O6Si2 — CID 15720344
methyl (1S,3R,4S,5S,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 15720344) has the molecular formula C20H40O6Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is methyl (1S,3R,4S,5S,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (1S,3R,4S,5S,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 15720344 |
| Molecular Formula | C20H40O6Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl (1S,3R,4S,5S,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)[C@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O2 |
| InChI | InChI=1S/C20H40O6Si2/c1-18(2,3)27(8,9)25-13-12-20(17(22)23-7)16(24-20)15(14(13)21)26-28(10,11)19(4,5)6/h13-16,21H,12H2,1-11H3/t13-,14+,15+,16-,20+/m1/s1 |
| InChIKey | PECNSOBLNIWQKA-QVTQBDIJSA-N |
| XLogP | 3.84 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|