C19H38O5Si2 — CID 11188858
(1S,3R,4R,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 11188858) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,3R,4R,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 11188858 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (1S,3R,4R,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)C[C@]2(O[Si](C)(C)C(C)(C)C)C[C@H]1OC2=O |
| InChI | InChI=1S/C19H38O5Si2/c1-17(2,3)25(7,8)23-15-13(20)11-19(12-14(15)22-16(19)21)24-26(9,10)18(4,5)6/h13-15,20H,11-12H2,1-10H3/t13-,14-,15-,19+/m1/s1 |
| InChIKey | GIIMEKKVJGVSGO-GPINWOSQSA-N |
| XLogP | 4.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|