C20H46O6Si4 — CID 631359
methyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate (PubChem CID 631359) has the molecular formula C20H46O6Si4 and a molecular weight of 494.93 g/mol. Its IUPAC name is methyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 631359 |
| Molecular Formula | C20H46O6Si4 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | methyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(O[Si](C)(C)C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C20H46O6Si4/c1-22-19(21)20(26-30(11,12)13)14-16(23-27(2,3)4)18(25-29(8,9)10)17(15-20)24-28(5,6)7/h16-18H,14-15H2,1-13H3 |
| InChIKey | IRRMBHNIHUUZLJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|