C25H52O5Si3 — CID 11827413
(1S,2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-triethylsilyloxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 11827413) has the molecular formula C25H52O5Si3 and a molecular weight of 516.94 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-triethylsilyloxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-triethylsilyloxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 11827413 |
| Molecular Formula | C25H52O5Si3 |
| Molecular Weight | 516.94 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | (1S,2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-triethylsilyloxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C[C@@H](OC2=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O5Si3/c1-14-33(15-2,16-3)30-22-20(28-31(10,11)24(4,5)6)18-17-19(27-23(18)26)21(22)29-32(12,13)25(7,8)9/h18-22H,14-17H2,1-13H3/t18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | MWLJLTGGNCZWGQ-LILSUDLASA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.94 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|