C19H38O4Si2 — CID 86660516
1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 86660516) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 86660516 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2(O[Si](C)(C)C(C)(C)C)CC1OC2=O |
| InChI | InChI=1S/C19H38O4Si2/c1-17(2,3)24(7,8)22-14-11-12-19(13-15(14)21-16(19)20)23-25(9,10)18(4,5)6/h14-15H,11-13H2,1-10H3 |
| InChIKey | XDPBSLKYIYMVAU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|