C16H30O3Si — CID 14720519
(1R,4R,5R)-4-tri(propan-2-yl)silyloxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 14720519) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (1R,4R,5R)-4-tri(propan-2-yl)silyloxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1R,4R,5R)-4-tri(propan-2-yl)silyloxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 14720519 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (1R,4R,5R)-4-tri(propan-2-yl)silyloxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(C)[Si](O[C@@H]1CC[C@@H]2C[C@H]1OC2=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-10(2)20(11(3)4,12(5)6)19-14-8-7-13-9-15(14)18-16(13)17/h10-15H,7-9H2,1-6H3/t13-,14-,15-/m1/s1 |
| InChIKey | URUZEDPROXWJET-RBSFLKMASA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|