C19H36O5Si2 — CID 86660517
(1S,4S,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octane-3,7-dione (PubChem CID 86660517) has the molecular formula C19H36O5Si2 and a molecular weight of 400.66 g/mol. Its IUPAC name is (1S,4S,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octane-3,7-dione.
| Compound Name | (1S,4S,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octane-3,7-dione |
|---|---|
| PubChem CID | 86660517 |
| Molecular Formula | C19H36O5Si2 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (1S,4S,5R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxabicyclo[3.2.1]octane-3,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)C[C@@]2(O[Si](C)(C)C(C)(C)C)C[C@H]1OC2=O |
| InChI | InChI=1S/C19H36O5Si2/c1-17(2,3)25(7,8)23-15-13(20)11-19(12-14(15)22-16(19)21)24-26(9,10)18(4,5)6/h14-15H,11-12H2,1-10H3/t14-,15-,19-/m1/s1 |
| InChIKey | FFOYFXDUTFZGGA-SPYBWZPUSA-N |
| XLogP | 4.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|