C19H38O6Si2 — CID 15720346
(1R,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylic acid (PubChem CID 15720346) has the molecular formula C19H38O6Si2 and a molecular weight of 418.68 g/mol. Its IUPAC name is (1R,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylic acid.
| Compound Name | (1R,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 15720346 |
| Molecular Formula | C19H38O6Si2 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (1R,3R,4S,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-7-oxabicyclo[4.1.0]heptane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C(=O)O)O[C@@H]12 |
| InChI | InChI=1S/C19H38O6Si2/c1-17(2,3)26(7,8)24-12-11-19(16(21)22)15(23-19)14(13(12)20)25-27(9,10)18(4,5)6/h12-15,20H,11H2,1-10H3,(H,21,22)/t12-,13+,14+,15+,19-/m1/s1 |
| InChIKey | MGLVUFSQBQMPDI-QWHKOUAISA-N |
| XLogP | 3.75 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|