C20H40O4Si — CID 134951460
1-[(2R,5S,6R)-5-methoxy-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone (PubChem CID 134951460) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is 1-[(2R,5S,6R)-5-methoxy-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone.
| Compound Name | 1-[(2R,5S,6R)-5-methoxy-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 134951460 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-[(2R,5S,6R)-5-methoxy-5-methyl-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone |
| SMILES | CO[C@@]1(C)CC[C@H](C(C)=O)O[C@@H]1CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-14(2)25(15(3)4,16(5)6)23-13-11-19-20(8,22-9)12-10-18(24-19)17(7)21/h14-16,18-19H,10-13H2,1-9H3/t18-,19-,20+/m1/s1 |
| InChIKey | MNXJECKBQJFFPU-AQNXPRMDSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|