C25H46O5Si — CID 134955103
(2R,4aR,6R,7S,8aS)-2-[[(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]methyl]-6,7,8a-trimethyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one (PubChem CID 134955103) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is (2R,4aR,6R,7S,8aS)-2-[[(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]methyl]-6,7,8a-trimethyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4aR,6R,7S,8aS)-2-[[(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]methyl]-6,7,8a-trimethyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 134955103 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (2R,4aR,6R,7S,8aS)-2-[[(2S,3R,5S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]methyl]-6,7,8a-trimethyl-4a,6,7,8-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
| SMILES | C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H]2O[C@@]3(C)C[C@H](C)[C@@H](C)O[C@@H]3CC2=O)O[C@@H]1C |
| InChI | InChI=1S/C25H46O5Si/c1-15-11-22(30-31(9,10)24(5,6)7)21(27-17(15)3)13-20-19(26)12-23-25(8,29-20)14-16(2)18(4)28-23/h15-18,20-23H,11-14H2,1-10H3/t15-,16-,17+,18+,20+,21-,22+,23+,25-/m0/s1 |
| InChIKey | RNZHMXMVVFPUMV-LMYUYYBKSA-N |
| XLogP | 5.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|