C17H32O4Si — CID 122394120
(4aS,6S,8aR)-2,2-ditert-butyl-4a-methyl-6-(2,2,2-trideuterioethyl)-8,8a-dihydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-7-one (PubChem CID 122394120) has the molecular formula C17H32O4Si and a molecular weight of 331.54 g/mol. Its IUPAC name is (4aS,6S,8aR)-2,2-ditert-butyl-4a-methyl-6-(2,2,2-trideuterioethyl)-8,8a-dihydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-7-one.
| Compound Name | (4aS,6S,8aR)-2,2-ditert-butyl-4a-methyl-6-(2,2,2-trideuterioethyl)-8,8a-dihydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-7-one |
|---|---|
| PubChem CID | 122394120 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (4aS,6S,8aR)-2,2-ditert-butyl-4a-methyl-6-(2,2,2-trideuterioethyl)-8,8a-dihydro-4H-pyrano[3,2-d][1,3,2]dioxasilin-7-one |
| SMILES | [2H]C([2H])([2H])C[C@@H]1O[C@@]2(C)CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]2CC1=O |
| InChI | InChI=1S/C17H32O4Si/c1-9-13-12(18)10-14-17(8,20-13)11-19-22(21-14,15(2,3)4)16(5,6)7/h13-14H,9-11H2,1-8H3/t13-,14+,17-/m0/s1/i1D3 |
| InChIKey | SKRGCDSPCHYXHL-OSZFJFIMSA-N |
| XLogP | 3.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|