C30H58O8Si2 — CID 11204203
(2R)-2-[[(2S,3S,4R,4aR,6R,7S,8aR)-7-methoxy-6-(methoxymethyl)-4a-methyl-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]methyl]oxan-3-one (PubChem CID 11204203) has the molecular formula C30H58O8Si2 and a molecular weight of 602.96 g/mol. Its IUPAC name is (2R)-2-[[(2S,3S,4R,4aR,6R,7S,8aR)-7-methoxy-6-(methoxymethyl)-4a-methyl-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]methyl]oxan-3-one.
| Compound Name | (2R)-2-[[(2S,3S,4R,4aR,6R,7S,8aR)-7-methoxy-6-(methoxymethyl)-4a-methyl-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]methyl]oxan-3-one |
|---|---|
| PubChem CID | 11204203 |
| Molecular Formula | C30H58O8Si2 |
| Molecular Weight | 602.96 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | (2R)-2-[[(2S,3S,4R,4aR,6R,7S,8aR)-7-methoxy-6-(methoxymethyl)-4a-methyl-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]methyl]oxan-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](C[C@H]2OCCCC2=O)O[C@@H]2C[C@H](OC)[C@@H](COC)O[C@@]2(C)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H58O8Si2/c1-10-39(11-2,12-3)37-28-25(19-23-22(31)17-16-18-34-23)35-27-20-24(33-9)26(21-32-8)36-30(27,7)29(28)38-40(13-4,14-5)15-6/h23-29H,10-21H2,1-9H3/t23-,24+,25+,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | ROOFSQPPIQXDND-HMNIKNHISA-N |
| XLogP | 5.88 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|