C23H44O6Si2 — CID 46901650
2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-methyl-13-trimethylsilyloxy-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde (PubChem CID 46901650) has the molecular formula C23H44O6Si2 and a molecular weight of 472.77 g/mol. Its IUPAC name is 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-methyl-13-trimethylsilyloxy-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde.
| Compound Name | 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-methyl-13-trimethylsilyloxy-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde |
|---|---|
| PubChem CID | 46901650 |
| Molecular Formula | C23H44O6Si2 |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-[(1S,3R,8S,10R,12S,13R)-6,6-ditert-butyl-13-methyl-13-trimethylsilyloxy-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H]3C[C@@](C)(O[Si](C)(C)C)[C@H](CC=O)O[C@@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C23H44O6Si2/c1-21(2,3)31(22(4,5)6)25-15-19-17(28-31)13-16-18(26-19)14-23(7,29-30(8,9)10)20(27-16)11-12-24/h12,16-20H,11,13-15H2,1-10H3/t16-,17+,18+,19-,20+,23-/m1/s1 |
| InChIKey | ZGXWNJLKICAVDZ-UCAXJUIRSA-N |
| XLogP | 4.96 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|