C21H36O5Si — CID 46900163
ethyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-10-oxo-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecane-8-carboxylate (PubChem CID 46900163) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is ethyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-10-oxo-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecane-8-carboxylate.
| Compound Name | ethyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-10-oxo-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecane-8-carboxylate |
|---|---|
| PubChem CID | 46900163 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | ethyl (1R,2R,5R,6R,7R,8R)-1,5-dimethyl-10-oxo-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undecane-8-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(=O)[C@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H36O5Si/c1-7-24-19(23)21-13-16(22)20(6,26-21)15-12-11-14(5)17(15)18(21)25-27(8-2,9-3)10-4/h14-15,17-18H,7-13H2,1-6H3/t14-,15-,17-,18-,20-,21-/m1/s1 |
| InChIKey | RCJYOMZHNOMCJH-MACOENJXSA-N |
| XLogP | 4.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|