C23H36O11Si — CID 11734025
dimethyl (1R,4R,5S,6R,7R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate (PubChem CID 11734025) has the molecular formula C23H36O11Si and a molecular weight of 516.62 g/mol. Its IUPAC name is dimethyl (1R,4R,5S,6R,7R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate.
| Compound Name | dimethyl (1R,4R,5S,6R,7R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 11734025 |
| Molecular Formula | C23H36O11Si |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | dimethyl (1R,4R,5S,6R,7R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-oxo-8-oxabicyclo[3.2.1]octane-6,7-dicarboxylate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(=O)[C@@]2(CO[Si](C)(C)C(C)(C)C)O[C@@H]1[C@H](C(=O)OC)[C@H]2C(=O)OC |
| InChI | InChI=1S/C23H36O11Si/c1-22(2,3)35(8,9)33-11-23-13(24)10-12(14(18(25)29-4)19(26)30-5)17(34-23)15(20(27)31-6)16(23)21(28)32-7/h12,14-17H,10-11H2,1-9H3/t12-,15-,16+,17+,23-/m1/s1 |
| InChIKey | XDFIWDHXSUOLOE-GSFGNOKXSA-N |
| XLogP | 1.28 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|