C29H56O7Si2 — CID 101451604
methyl (4R,5R,6R)-6-heptyl-5-methyl-3-oxo-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate (PubChem CID 101451604) has the molecular formula C29H56O7Si2 and a molecular weight of 572.93 g/mol. Its IUPAC name is methyl (4R,5R,6R)-6-heptyl-5-methyl-3-oxo-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate.
| Compound Name | methyl (4R,5R,6R)-6-heptyl-5-methyl-3-oxo-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate |
|---|---|
| PubChem CID | 101451604 |
| Molecular Formula | C29H56O7Si2 |
| Molecular Weight | 572.93 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | methyl (4R,5R,6R)-6-heptyl-5-methyl-3-oxo-4,5-bis(triethylsilyloxy)-4,6-dihydro-3aH-furo[2,3-b]pyran-7a-carboxylate |
| SMILES | CCCCCCC[C@H]1OC2(C(=O)OC)OCC(=O)C2[C@@H](O[Si](CC)(CC)CC)[C@]1(C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H56O7Si2/c1-10-17-18-19-20-21-24-28(8,36-38(14-5,15-6)16-7)26(35-37(11-2,12-3)13-4)25-23(30)22-33-29(25,34-24)27(31)32-9/h24-26H,10-22H2,1-9H3/t24-,25?,26-,28-,29?/m1/s1 |
| InChIKey | WJJBZLSHKZFATC-PYZONJPTSA-N |
| XLogP | 7.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.93 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|