C27H50O8Si3 — CID 11387715
(1S,2S,3R,5S,6R,7S,9S,13S,16R)-3,7,11,11,13-pentamethyl-5,7,16-tris(trimethylsilyloxy)-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione (PubChem CID 11387715) has the molecular formula C27H50O8Si3 and a molecular weight of 586.95 g/mol. Its IUPAC name is (1S,2S,3R,5S,6R,7S,9S,13S,16R)-3,7,11,11,13-pentamethyl-5,7,16-tris(trimethylsilyloxy)-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione.
| Compound Name | (1S,2S,3R,5S,6R,7S,9S,13S,16R)-3,7,11,11,13-pentamethyl-5,7,16-tris(trimethylsilyloxy)-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
|---|---|
| PubChem CID | 11387715 |
| Molecular Formula | C27H50O8Si3 |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (1S,2S,3R,5S,6R,7S,9S,13S,16R)-3,7,11,11,13-pentamethyl-5,7,16-tris(trimethylsilyloxy)-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
| SMILES | C[C@H]1C(=O)[C@@H](O[Si](C)(C)C)[C@H]2[C@@H]1[C@@H]1OC(=O)[C@@]3(C)OC(C)(C)O[C@@H](C[C@]2(C)O[Si](C)(C)C)[C@@]13O[Si](C)(C)C |
| InChI | InChI=1S/C27H50O8Si3/c1-16-18-19(21(20(16)28)32-36(6,7)8)25(4,34-37(9,10)11)15-17-27(35-38(12,13)14)22(18)30-23(29)26(27,5)33-24(2,3)31-17/h16-19,21-22H,15H2,1-14H3/t16-,17+,18-,19-,21+,22+,25+,26-,27-/m1/s1 |
| InChIKey | SQSCPFULIOCQMV-CQUCDRBVSA-N |
| XLogP | 5.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|