C22H36O7Si — CID 11305264
diethyl (1S,5S,7R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-oxatricyclo[5.3.1.01,5]undecane-3,3-dicarboxylate (PubChem CID 11305264) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is diethyl (1S,5S,7R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-oxatricyclo[5.3.1.01,5]undecane-3,3-dicarboxylate.
| Compound Name | diethyl (1S,5S,7R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-oxatricyclo[5.3.1.01,5]undecane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11305264 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | diethyl (1S,5S,7R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-oxatricyclo[5.3.1.01,5]undecane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2C[C@@H]3CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C1)O3 |
| InChI | InChI=1S/C22H36O7Si/c1-8-26-18(24)21(19(25)27-9-2)12-14-10-15-11-16(23)17(22(14,13-21)28-15)29-30(6,7)20(3,4)5/h14-15,17H,8-13H2,1-7H3/t14-,15-,17+,22+/m1/s1 |
| InChIKey | KEEHZHQGLQNKLM-WQLIQUDQSA-N |
| XLogP | 3.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|