C24H40O6Si — CID 177452754
(1R,6R,7S,11S,12R)-6-acetyl-6,11-dimethyl-12-tri(propan-2-yl)silyloxy-4,8-dioxatricyclo[5.3.3.01,7]tridecane-3,9-dione (PubChem CID 177452754) has the molecular formula C24H40O6Si and a molecular weight of 452.66 g/mol. Its IUPAC name is (1R,6R,7S,11S,12R)-6-acetyl-6,11-dimethyl-12-tri(propan-2-yl)silyloxy-4,8-dioxatricyclo[5.3.3.01,7]tridecane-3,9-dione.
| Compound Name | (1R,6R,7S,11S,12R)-6-acetyl-6,11-dimethyl-12-tri(propan-2-yl)silyloxy-4,8-dioxatricyclo[5.3.3.01,7]tridecane-3,9-dione |
|---|---|
| PubChem CID | 177452754 |
| Molecular Formula | C24H40O6Si |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (1R,6R,7S,11S,12R)-6-acetyl-6,11-dimethyl-12-tri(propan-2-yl)silyloxy-4,8-dioxatricyclo[5.3.3.01,7]tridecane-3,9-dione |
| SMILES | CC(=O)[C@]1(C)COC(=O)C[C@]23CC(=O)O[C@@]21C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]3C |
| InChI | InChI=1S/C24H40O6Si/c1-14(2)31(15(3)4,16(5)6)30-19-10-24-22(9,18(8)25)13-28-20(26)11-23(24,17(19)7)12-21(27)29-24/h14-17,19H,10-13H2,1-9H3/t17-,19-,22+,23-,24-/m1/s1 |
| InChIKey | IGXAHDWGEPEDOZ-PCRSXPRCSA-N |
| XLogP | 4.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|