C24H36O10Si — CID 11135032
dimethyl 2-[(1R,4R,7S,10S,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-12-methoxycarbonyl-2,8-dioxo-3-oxatricyclo[5.4.1.04,12]dodecan-10-yl]propanedioate (PubChem CID 11135032) has the molecular formula C24H36O10Si and a molecular weight of 512.63 g/mol. Its IUPAC name is dimethyl 2-[(1R,4R,7S,10S,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-12-methoxycarbonyl-2,8-dioxo-3-oxatricyclo[5.4.1.04,12]dodecan-10-yl]propanedioate.
| Compound Name | dimethyl 2-[(1R,4R,7S,10S,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-12-methoxycarbonyl-2,8-dioxo-3-oxatricyclo[5.4.1.04,12]dodecan-10-yl]propanedioate |
|---|---|
| PubChem CID | 11135032 |
| Molecular Formula | C24H36O10Si |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | dimethyl 2-[(1R,4R,7S,10S,11S,12S)-11-[tert-butyl(dimethyl)silyl]oxy-12-methoxycarbonyl-2,8-dioxo-3-oxatricyclo[5.4.1.04,12]dodecan-10-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(=O)[C@H]2CC[C@H]3OC(=O)[C@@H]([C@H]1O[Si](C)(C)C(C)(C)C)[C@@]23C(=O)OC |
| InChI | InChI=1S/C24H36O10Si/c1-23(2,3)35(7,8)34-18-12(16(19(26)30-4)20(27)31-5)11-14(25)13-9-10-15-24(13,22(29)32-6)17(18)21(28)33-15/h12-13,15-18H,9-11H2,1-8H3/t12-,13-,15-,17-,18+,24-/m1/s1 |
| InChIKey | JUPKTLPDXKCMJL-UWWQAVARSA-N |
| XLogP | 2.04 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|