C20H30O7 — CID 11610640
(1S,2S,3R,6S,7S,9S,13S,16R)-7-ethoxy-16-hydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione (PubChem CID 11610640) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (1S,2S,3R,6S,7S,9S,13S,16R)-7-ethoxy-16-hydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione.
| Compound Name | (1S,2S,3R,6S,7S,9S,13S,16R)-7-ethoxy-16-hydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
|---|---|
| PubChem CID | 11610640 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S,2S,3R,6S,7S,9S,13S,16R)-7-ethoxy-16-hydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
| SMILES | CCO[C@@]1(C)C[C@@H]2OC(C)(C)O[C@]3(C)C(=O)O[C@@H]([C@@H]4[C@@H](C)C(=O)C[C@@H]41)[C@]23O |
| InChI | InChI=1S/C20H30O7/c1-7-24-18(5)9-13-20(23)15(14-10(2)12(21)8-11(14)18)25-16(22)19(20,6)27-17(3,4)26-13/h10-11,13-15,23H,7-9H2,1-6H3/t10-,11-,13-,14+,15-,18-,19+,20+/m0/s1 |
| InChIKey | TYRMZMSOEDTWLW-QUNWNVAPSA-N |
| XLogP | 1.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |