C11H18O6 — CID 538995
3,7-dihydroxy-3a-methoxy-5,6,7-trimethyl-3,5,6,7a-tetrahydrofuro[3,2-b]pyran-2-one (PubChem CID 538995) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 3,7-dihydroxy-3a-methoxy-5,6,7-trimethyl-3,5,6,7a-tetrahydrofuro[3,2-b]pyran-2-one.
| Compound Name | 3,7-dihydroxy-3a-methoxy-5,6,7-trimethyl-3,5,6,7a-tetrahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 538995 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3,7-dihydroxy-3a-methoxy-5,6,7-trimethyl-3,5,6,7a-tetrahydrofuro[3,2-b]pyran-2-one |
| SMILES | COC12OC(C)C(C)C(C)(O)C1OC(=O)C2O |
| InChI | InChI=1S/C11H18O6/c1-5-6(2)17-11(15-4)7(12)8(13)16-9(11)10(5,3)14/h5-7,9,12,14H,1-4H3 |
| InChIKey | JTZOZXVRPIUVET-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |