C20H32O5 — CID 134867126
(1S,2R,3S,4S,6S,9S,13S,16R)-16-hydroxy-3,4,7,7,11,11,13-heptamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one (PubChem CID 134867126) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,2R,3S,4S,6S,9S,13S,16R)-16-hydroxy-3,4,7,7,11,11,13-heptamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one.
| Compound Name | (1S,2R,3S,4S,6S,9S,13S,16R)-16-hydroxy-3,4,7,7,11,11,13-heptamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one |
|---|---|
| PubChem CID | 134867126 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1S,2R,3S,4S,6S,9S,13S,16R)-16-hydroxy-3,4,7,7,11,11,13-heptamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one |
| SMILES | C[C@@H]1[C@@H]2[C@H](C[C@@H]1C)C(C)(C)C[C@@H]1OC(C)(C)O[C@]3(C)C(=O)O[C@@H]2[C@]13O |
| InChI | InChI=1S/C20H32O5/c1-10-8-12-14(11(10)2)15-20(22)13(9-17(12,3)4)24-18(5,6)25-19(20,7)16(21)23-15/h10-15,22H,8-9H2,1-7H3/t10-,11-,12-,13-,14+,15-,19+,20+/m0/s1 |
| InChIKey | XLCRIJXAEVWWRV-UJBFDBJKSA-N |
| XLogP | 2.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |