C19H28O6 — CID 134866593
(1S,2S,3R,6S,9S,13S,16R)-16-hydroxy-3,7,7,11,11,13-hexamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione (PubChem CID 134866593) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1S,2S,3R,6S,9S,13S,16R)-16-hydroxy-3,7,7,11,11,13-hexamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione.
| Compound Name | (1S,2S,3R,6S,9S,13S,16R)-16-hydroxy-3,7,7,11,11,13-hexamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
|---|---|
| PubChem CID | 134866593 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1S,2S,3R,6S,9S,13S,16R)-16-hydroxy-3,7,7,11,11,13-hexamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecane-4,14-dione |
| SMILES | C[C@H]1C(=O)C[C@H]2[C@@H]1[C@@H]1OC(=O)[C@@]3(C)OC(C)(C)O[C@@H](CC2(C)C)[C@@]13O |
| InChI | InChI=1S/C19H28O6/c1-9-11(20)7-10-13(9)14-19(22)12(8-16(10,2)3)24-17(4,5)25-18(19,6)15(21)23-14/h9-10,12-14,22H,7-8H2,1-6H3/t9-,10-,12-,13+,14-,18+,19+/m0/s1 |
| InChIKey | NXYUFULGSPYFLC-MAAJKTHUSA-N |
| XLogP | 1.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |