C20H30O6 — CID 23263962
(3-hydroxy-3,6,9-trimethyl-2,7-dioxo-4,5,6,6a,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylbutanoate (PubChem CID 23263962) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (3-hydroxy-3,6,9-trimethyl-2,7-dioxo-4,5,6,6a,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylbutanoate.
| Compound Name | (3-hydroxy-3,6,9-trimethyl-2,7-dioxo-4,5,6,6a,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 23263962 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (3-hydroxy-3,6,9-trimethyl-2,7-dioxo-4,5,6,6a,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C2C(=O)CC(C)C2C2OC(=O)C(C)(O)C12 |
| InChI | InChI=1S/C20H30O6/c1-6-9(2)18(22)25-13-8-11(4)14-12(21)7-10(3)15(14)17-16(13)20(5,24)19(23)26-17/h9-11,13-17,24H,6-8H2,1-5H3 |
| InChIKey | XRYLAIHYFHIXMY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |