C17H22O6 — CID 163086194
[(3R,3aR,6aR,9S,9aR,9bR)-3-hydroxy-9-methyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-3-yl]methyl acetate (PubChem CID 163086194) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(3R,3aR,6aR,9S,9aR,9bR)-3-hydroxy-9-methyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-3-yl]methyl acetate.
| Compound Name | [(3R,3aR,6aR,9S,9aR,9bR)-3-hydroxy-9-methyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 163086194 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(3R,3aR,6aR,9S,9aR,9bR)-3-hydroxy-9-methyl-6-methylidene-2,8-dioxo-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-3-yl]methyl acetate |
| SMILES | C=C1CC[C@@H]2[C@H](OC(=O)[C@]2(O)COC(C)=O)[C@H]2[C@H](C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H22O6/c1-8-4-5-12-15(14-9(2)13(19)6-11(8)14)23-16(20)17(12,21)7-22-10(3)18/h9,11-12,14-15,21H,1,4-7H2,2-3H3/t9-,11+,12-,14+,15+,17+/m1/s1 |
| InChIKey | IRSYULSNVRLREI-OBMCMEANSA-N |
| XLogP | 1.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|