C19H26O7 — CID 44567603
[(3R,3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] 2,3-dihydroxy-2-methylpropanoate (PubChem CID 44567603) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(3R,3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] 2,3-dihydroxy-2-methylpropanoate.
| Compound Name | [(3R,3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] 2,3-dihydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 44567603 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(3R,3aR,4S,6aR,8S,9aR,9bR)-8-hydroxy-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-4-yl] 2,3-dihydroxy-2-methylpropanoate |
| SMILES | C=C1[C@@H]2[C@H]3OC(=O)[C@H](C)[C@@H]3[C@@H](OC(=O)C(C)(O)CO)CC(=C)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C19H26O7/c1-8-5-13(25-18(23)19(4,24)7-20)15-10(3)17(22)26-16(15)14-9(2)12(21)6-11(8)14/h10-16,20-21,24H,1-2,5-7H2,3-4H3/t10-,11+,12+,13+,14+,15-,16-,19?/m1/s1 |
| InChIKey | XXTSIUYSUUNNEI-HYVDOFMESA-N |
| XLogP | 0.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|