C18H32O5Si — CID 122389869
tert-butyl (1R,5R,7R)-2-oxo-5-propan-2-yl-7-trimethylsilyloxy-8-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 122389869) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is tert-butyl (1R,5R,7R)-2-oxo-5-propan-2-yl-7-trimethylsilyloxy-8-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | tert-butyl (1R,5R,7R)-2-oxo-5-propan-2-yl-7-trimethylsilyloxy-8-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 122389869 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl (1R,5R,7R)-2-oxo-5-propan-2-yl-7-trimethylsilyloxy-8-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | CC(C)[C@]12CCC(=O)[C@](C(=O)OC(C)(C)C)(O1)[C@H](O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C18H32O5Si/c1-12(2)17-10-9-13(19)18(23-17,15(20)21-16(3,4)5)14(11-17)22-24(6,7)8/h12,14H,9-11H2,1-8H3/t14-,17-,18+/m1/s1 |
| InChIKey | HAYSQPXUHXIVEI-OLMNPRSZSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|