C31H64O6Si3 — CID 11734773
3-hexanoyl-4-[(1R,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one (PubChem CID 11734773) has the molecular formula C31H64O6Si3 and a molecular weight of 617.11 g/mol. Its IUPAC name is 3-hexanoyl-4-[(1R,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one.
| Compound Name | 3-hexanoyl-4-[(1R,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one |
|---|---|
| PubChem CID | 11734773 |
| Molecular Formula | C31H64O6Si3 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | 3-hexanoyl-4-[(1R,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one |
| SMILES | CCCCCC(=O)C1C(=O)OCC1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O6Si3/c1-17-18-19-20-24(32)26-23(21-34-28(26)33)27(37-40(15,16)31(8,9)10)25(36-39(13,14)30(5,6)7)22-35-38(11,12)29(2,3)4/h23,25-27H,17-22H2,1-16H3/t23?,25-,26?,27-/m1/s1 |
| InChIKey | KQAUAVHJVHZOAL-UDVZQLPGSA-N |
| XLogP | 8.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|