C19H32O9Si — CID 11464633
trimethyl (1S,2R,5S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate (PubChem CID 11464633) has the molecular formula C19H32O9Si and a molecular weight of 432.54 g/mol. Its IUPAC name is trimethyl (1S,2R,5S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate.
| Compound Name | trimethyl (1S,2R,5S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
|---|---|
| PubChem CID | 11464633 |
| Molecular Formula | C19H32O9Si |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | trimethyl (1S,2R,5S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
| SMILES | COC(=O)[C@H]1O[C@]2(C)CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)OC)[C@@]1(C(=O)OC)O2 |
| InChI | InChI=1S/C19H32O9Si/c1-16(2,3)29(8,9)28-18(14(21)24-6)11-10-17(4)26-12(13(20)23-5)19(18,27-17)15(22)25-7/h12H,10-11H2,1-9H3/t12-,17+,18+,19-/m1/s1 |
| InChIKey | MMBVBKMKPZOMRF-NVAWSTJUSA-N |
| XLogP | 1.93 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|