C20H46O7Si4 — CID 91752368
trimethylsilyl 6-ethoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91752368) has the molecular formula C20H46O7Si4 and a molecular weight of 510.93 g/mol. Its IUPAC name is trimethylsilyl 6-ethoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-ethoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752368 |
| Molecular Formula | C20H46O7Si4 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | trimethylsilyl 6-ethoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CCOC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C20H46O7Si4/c1-14-22-20-18(26-30(8,9)10)16(25-29(5,6)7)15(24-28(2,3)4)17(23-20)19(21)27-31(11,12)13/h15-18,20H,14H2,1-13H3 |
| InChIKey | ZVFLDYSKELVZGO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|