C22H50O7Si4 — CID 91752365
trimethylsilyl 6-butoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91752365) has the molecular formula C22H50O7Si4 and a molecular weight of 538.98 g/mol. Its IUPAC name is trimethylsilyl 6-butoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-butoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752365 |
| Molecular Formula | C22H50O7Si4 |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | trimethylsilyl 6-butoxy-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CCCCOC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C22H50O7Si4/c1-14-15-16-24-22-20(28-32(8,9)10)18(27-31(5,6)7)17(26-30(2,3)4)19(25-22)21(23)29-33(11,12)13/h17-20,22H,14-16H2,1-13H3 |
| InChIKey | GMRMNCAZQIACMI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|