C12H24O9 — CID 11404167
tert-butyl (2S,3R,4R,5S,6S,7R)-2,3,4,5,6,7,8-heptahydroxyoctanoate (PubChem CID 11404167) has the molecular formula C12H24O9 and a molecular weight of 312.32 g/mol. Its IUPAC name is tert-butyl (2S,3R,4R,5S,6S,7R)-2,3,4,5,6,7,8-heptahydroxyoctanoate.
| Compound Name | tert-butyl (2S,3R,4R,5S,6S,7R)-2,3,4,5,6,7,8-heptahydroxyoctanoate |
|---|---|
| PubChem CID | 11404167 |
| Molecular Formula | C12H24O9 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl (2S,3R,4R,5S,6S,7R)-2,3,4,5,6,7,8-heptahydroxyoctanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24O9/c1-12(2,3)21-11(20)10(19)9(18)8(17)7(16)6(15)5(14)4-13/h5-10,13-19H,4H2,1-3H3/t5-,6+,7+,8-,9-,10+/m1/s1 |
| InChIKey | BDFFJTKAHUXXFZ-RZOIJWCNSA-N |
| XLogP | -3.51 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |