C17H34O5Si — CID 134880975
methyl (5R,6R)-5-hydroxy-3-oxo-6-tri(propan-2-yl)silyloxyheptanoate (PubChem CID 134880975) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is methyl (5R,6R)-5-hydroxy-3-oxo-6-tri(propan-2-yl)silyloxyheptanoate.
| Compound Name | methyl (5R,6R)-5-hydroxy-3-oxo-6-tri(propan-2-yl)silyloxyheptanoate |
|---|---|
| PubChem CID | 134880975 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | methyl (5R,6R)-5-hydroxy-3-oxo-6-tri(propan-2-yl)silyloxyheptanoate |
| SMILES | COC(=O)CC(=O)C[C@@H](O)[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-11(2)23(12(3)4,13(5)6)22-14(7)16(19)9-15(18)10-17(20)21-8/h11-14,16,19H,9-10H2,1-8H3/t14-,16-/m1/s1 |
| InChIKey | RYCJYICLWUEXPF-GDBMZVCRSA-N |
| XLogP | 3.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|