C30H66O5Si3 — CID 91733313
methyl 5,14,15-tris(trimethylsilyloxy)icosanoate (PubChem CID 91733313) has the molecular formula C30H66O5Si3 and a molecular weight of 591.11 g/mol. Its IUPAC name is methyl 5,14,15-tris(trimethylsilyloxy)icosanoate.
| Compound Name | methyl 5,14,15-tris(trimethylsilyloxy)icosanoate |
|---|---|
| PubChem CID | 91733313 |
| Molecular Formula | C30H66O5Si3 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | methyl 5,14,15-tris(trimethylsilyloxy)icosanoate |
| SMILES | CCCCCC(O[Si](C)(C)C)C(CCCCCCCCC(CCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H66O5Si3/c1-12-13-18-24-28(34-37(6,7)8)29(35-38(9,10)11)25-20-17-15-14-16-19-22-27(33-36(3,4)5)23-21-26-30(31)32-2/h27-29H,12-26H2,1-11H3 |
| InChIKey | HMUJFBFXZVUXLW-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|