C31H70O6Si4 — CID 609001
methyl 5,6,12,13-tetrakis(trimethylsilyloxy)octadecanoate (PubChem CID 609001) has the molecular formula C31H70O6Si4 and a molecular weight of 651.24 g/mol. Its IUPAC name is methyl 5,6,12,13-tetrakis(trimethylsilyloxy)octadecanoate.
| Compound Name | methyl 5,6,12,13-tetrakis(trimethylsilyloxy)octadecanoate |
|---|---|
| PubChem CID | 609001 |
| Molecular Formula | C31H70O6Si4 |
| Molecular Weight | 651.24 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | methyl 5,6,12,13-tetrakis(trimethylsilyloxy)octadecanoate |
| SMILES | CCCCCC(O[Si](C)(C)C)C(CCCCCC(O[Si](C)(C)C)C(CCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C31H70O6Si4/c1-15-16-18-22-27(34-38(3,4)5)28(35-39(6,7)8)23-19-17-20-24-29(36-40(9,10)11)30(37-41(12,13)14)25-21-26-31(32)33-2/h27-30H,15-26H2,1-14H3 |
| InChIKey | OTCRWNBFQPJOTL-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.24 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|