C26H50O6Si — CID 138978688
ethyl 8-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-2-hydroxy-1-(1-methylcyclopropyl)oxyethyl]oxolan-2-yl]octanoate (PubChem CID 138978688) has the molecular formula C26H50O6Si and a molecular weight of 486.77 g/mol. Its IUPAC name is ethyl 8-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-2-hydroxy-1-(1-methylcyclopropyl)oxyethyl]oxolan-2-yl]octanoate.
| Compound Name | ethyl 8-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-2-hydroxy-1-(1-methylcyclopropyl)oxyethyl]oxolan-2-yl]octanoate |
|---|---|
| PubChem CID | 138978688 |
| Molecular Formula | C26H50O6Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | ethyl 8-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S)-2-hydroxy-1-(1-methylcyclopropyl)oxyethyl]oxolan-2-yl]octanoate |
| SMILES | CCOC(=O)CCCCCCC[C@H]1O[C@@H]([C@H](CO)OC2(C)CC2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O6Si/c1-8-29-24(28)15-13-11-9-10-12-14-20-22(32-33(6,7)25(2,3)4)18-21(30-20)23(19-27)31-26(5)16-17-26/h20-23,27H,8-19H2,1-7H3/t20-,21-,22+,23+/m1/s1 |
| InChIKey | KKRVSPPAUZPCBH-LUKWVAJMSA-N |
| XLogP | 5.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|