C26H54O7Si2 — CID 59916207
[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-hydroxy-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59916207) has the molecular formula C26H54O7Si2 and a molecular weight of 534.88 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-hydroxy-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-hydroxy-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59916207 |
| Molecular Formula | C26H54O7Si2 |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-hydroxy-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](COC(=O)C(C)(C)C)O[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O7Si2/c1-24(2,3)23(28)30-17-20-21(27)22(29-10)19(32-20)15-18(33-35(13,14)26(7,8)9)16-31-34(11,12)25(4,5)6/h18-22,27H,15-17H2,1-14H3/t18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | CQKUEULLEDWMAP-WIYBCGNWSA-N |
| XLogP | 5.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|