C26H50O12 — CID 23843944
[3-hydroxy-1-oxo-1-(2,3,4,5,6-pentahydroxyhexoxy)decan-5-yl] 3,5-dihydroxydecanoate (PubChem CID 23843944) has the molecular formula C26H50O12 and a molecular weight of 554.67 g/mol. Its IUPAC name is [3-hydroxy-1-oxo-1-(2,3,4,5,6-pentahydroxyhexoxy)decan-5-yl] 3,5-dihydroxydecanoate.
| Compound Name | [3-hydroxy-1-oxo-1-(2,3,4,5,6-pentahydroxyhexoxy)decan-5-yl] 3,5-dihydroxydecanoate |
|---|---|
| PubChem CID | 23843944 |
| Molecular Formula | C26H50O12 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | [3-hydroxy-1-oxo-1-(2,3,4,5,6-pentahydroxyhexoxy)decan-5-yl] 3,5-dihydroxydecanoate |
| SMILES | CCCCCC(O)CC(O)CC(=O)OC(CCCCC)CC(O)CC(=O)OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C26H50O12/c1-3-5-7-9-17(28)11-18(29)14-24(34)38-20(10-8-6-4-2)12-19(30)13-23(33)37-16-22(32)26(36)25(35)21(31)15-27/h17-22,25-32,35-36H,3-16H2,1-2H3 |
| InChIKey | JPGYRFJJNVYGPI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|