C16H34O8Si3 — CID 91366664
5-(1,2-dihydroxyethyl)-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,4-dione (PubChem CID 91366664) has the molecular formula C16H34O8Si3 and a molecular weight of 438.70 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,4-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,4-dione |
|---|---|
| PubChem CID | 91366664 |
| Molecular Formula | C16H34O8Si3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]oxolane-2,4-dione |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOC1C(=O)OC(C(O)CO)C1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O8Si3/c1-25(2,3)23-27(7,24-26(4,5)6)10-8-9-21-15-13(19)14(12(18)11-17)22-16(15)20/h12,14-15,17-18H,8-11H2,1-7H3 |
| InChIKey | YRRWYWLJQKHFCZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|